C15H18N6O4 — CID 120752137
[4-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]piperazin-1-yl]-(4-nitrophenyl)methanone (PubChem CID 120752137) has the molecular formula C15H18N6O4 and a molecular weight of 346.35 g/mol. Its IUPAC name is [4-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]piperazin-1-yl]-(4-nitrophenyl)methanone.
| Compound Name | [4-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]piperazin-1-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 120752137 |
| Molecular Formula | C15H18N6O4 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | [4-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]piperazin-1-yl]-(4-nitrophenyl)methanone |
| SMILES | NCc1nc(CN2CCN(C(=O)c3ccc([N+](=O)[O-])cc3)CC2)no1 |
| InChI | InChI=1S/C15H18N6O4/c16-9-14-17-13(18-25-14)10-19-5-7-20(8-6-19)15(22)11-1-3-12(4-2-11)21(23)24/h1-4H,5-10,16H2 |
| InChIKey | BHWCYKFEDBVJCQ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 131.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|