C21H21N5O4 — CID 42691953
[4-[[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl]piperazin-1-yl]-(4-nitrophenyl)methanone (PubChem CID 42691953) has the molecular formula C21H21N5O4 and a molecular weight of 407.43 g/mol. Its IUPAC name is [4-[[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl]piperazin-1-yl]-(4-nitrophenyl)methanone.
| Compound Name | [4-[[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl]piperazin-1-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 42691953 |
| Molecular Formula | C21H21N5O4 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | [4-[[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]methyl]piperazin-1-yl]-(4-nitrophenyl)methanone |
| SMILES | Cc1ccc(-c2nc(CN3CCN(C(=O)c4ccc([N+](=O)[O-])cc4)CC3)no2)cc1 |
| InChI | InChI=1S/C21H21N5O4/c1-15-2-4-16(5-3-15)20-22-19(23-30-20)14-24-10-12-25(13-11-24)21(27)17-6-8-18(9-7-17)26(28)29/h2-9H,10-14H2,1H3 |
| InChIKey | WAMHVEUIXWCUHX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 105.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|