C15H18N4O3S3 — CID 7883394
N,N-diethyl-2-[[5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 7883394) has the molecular formula C15H18N4O3S3 and a molecular weight of 398.54 g/mol. Its IUPAC name is N,N-diethyl-2-[[5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N,N-diethyl-2-[[5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 7883394 |
| Molecular Formula | C15H18N4O3S3 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | N,N-diethyl-2-[[5-[(4-nitrophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | CCN(CC)C(=O)CSc1nnc(SCc2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C15H18N4O3S3/c1-3-18(4-2)13(20)10-24-15-17-16-14(25-15)23-9-11-5-7-12(8-6-11)19(21)22/h5-8H,3-4,9-10H2,1-2H3 |
| InChIKey | GTUXDWKWGUGHTM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 89.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|