C17H10F2O4 — CID 71511144
8-(3,4-difluorobenzoyl)-7-hydroxy-4-methylchromen-2-one (PubChem CID 71511144) has the molecular formula C17H10F2O4 and a molecular weight of 316.26 g/mol. Its IUPAC name is 8-(3,4-difluorobenzoyl)-7-hydroxy-4-methylchromen-2-one.
| Compound Name | 8-(3,4-difluorobenzoyl)-7-hydroxy-4-methylchromen-2-one |
|---|---|
| PubChem CID | 71511144 |
| Molecular Formula | C17H10F2O4 |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 8-(3,4-difluorobenzoyl)-7-hydroxy-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2c(C(=O)c3ccc(F)c(F)c3)c(O)ccc12 |
| InChI | InChI=1S/C17H10F2O4/c1-8-6-14(21)23-17-10(8)3-5-13(20)15(17)16(22)9-2-4-11(18)12(19)7-9/h2-7,20H,1H3 |
| InChIKey | PCPQUUQMNLKTBA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|