C23H28ClNO3 — CID 44668182
4-butyl-6-[(2,3-dimethylanilino)methyl]-7-hydroxy-8-methylchromen-2-one;hydrochloride (PubChem CID 44668182) has the molecular formula C23H28ClNO3 and a molecular weight of 401.93 g/mol. Its IUPAC name is 4-butyl-6-[(2,3-dimethylanilino)methyl]-7-hydroxy-8-methylchromen-2-one;hydrochloride.
| Compound Name | 4-butyl-6-[(2,3-dimethylanilino)methyl]-7-hydroxy-8-methylchromen-2-one;hydrochloride |
|---|---|
| PubChem CID | 44668182 |
| Molecular Formula | C23H28ClNO3 |
| Molecular Weight | 401.93 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 4-butyl-6-[(2,3-dimethylanilino)methyl]-7-hydroxy-8-methylchromen-2-one;hydrochloride |
| SMILES | CCCCc1cc(=O)oc2c(C)c(O)c(CNc3cccc(C)c3C)cc12.Cl |
| InChI | InChI=1S/C23H27NO3.ClH/c1-5-6-9-17-12-21(25)27-23-16(4)22(26)18(11-19(17)23)13-24-20-10-7-8-14(2)15(20)3;/h7-8,10-12,24,26H,5-6,9,13H2,1-4H3;1H |
| InChIKey | PROBBWHAASZNCH-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.93 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|