C22H23NO3S — CID 2115115
2-[(7,8-dimethyl-2-oxochromen-4-yl)methylsulfanyl]-N-(3,4-dimethylphenyl)acetamide (PubChem CID 2115115) has the molecular formula C22H23NO3S and a molecular weight of 381.50 g/mol. Its IUPAC name is 2-[(7,8-dimethyl-2-oxochromen-4-yl)methylsulfanyl]-N-(3,4-dimethylphenyl)acetamide.
| Compound Name | 2-[(7,8-dimethyl-2-oxochromen-4-yl)methylsulfanyl]-N-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 2115115 |
| Molecular Formula | C22H23NO3S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 2-[(7,8-dimethyl-2-oxochromen-4-yl)methylsulfanyl]-N-(3,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CSCc2cc(=O)oc3c(C)c(C)ccc23)cc1C |
| InChI | InChI=1S/C22H23NO3S/c1-13-5-7-18(9-15(13)3)23-20(24)12-27-11-17-10-21(25)26-22-16(4)14(2)6-8-19(17)22/h5-10H,11-12H2,1-4H3,(H,23,24) |
| InChIKey | WVKKOSPCUBQSRP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|