C16H21NO4S — CID 28697785
ethyl 4-[2-(3,4-dimethylanilino)-2-oxoethyl]sulfanyl-3-oxobutanoate (PubChem CID 28697785) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is ethyl 4-[2-(3,4-dimethylanilino)-2-oxoethyl]sulfanyl-3-oxobutanoate.
| Compound Name | ethyl 4-[2-(3,4-dimethylanilino)-2-oxoethyl]sulfanyl-3-oxobutanoate |
|---|---|
| PubChem CID | 28697785 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | ethyl 4-[2-(3,4-dimethylanilino)-2-oxoethyl]sulfanyl-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)CSCC(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C16H21NO4S/c1-4-21-16(20)8-14(18)9-22-10-15(19)17-13-6-5-11(2)12(3)7-13/h5-7H,4,8-10H2,1-3H3,(H,17,19) |
| InChIKey | ZGXXZYGPIVZJTQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|