C12H14NO3S- — CID 6952062
2-[2-(3,4-dimethylanilino)-2-oxoethyl]sulfanylacetate (PubChem CID 6952062) has the molecular formula C12H14NO3S- and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-[2-(3,4-dimethylanilino)-2-oxoethyl]sulfanylacetate.
| Compound Name | 2-[2-(3,4-dimethylanilino)-2-oxoethyl]sulfanylacetate |
|---|---|
| PubChem CID | 6952062 |
| Molecular Formula | C12H14NO3S- |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 2-[2-(3,4-dimethylanilino)-2-oxoethyl]sulfanylacetate |
| SMILES | Cc1ccc(NC(=O)CSCC(=O)[O-])cc1C |
| InChI | InChI=1S/C12H15NO3S/c1-8-3-4-10(5-9(8)2)13-11(14)6-17-7-12(15)16/h3-5H,6-7H2,1-2H3,(H,13,14)(H,15,16)/p-1 |
| InChIKey | PUFZPTYMIKIBMZ-UHFFFAOYSA-M |
| XLogP | 0.73 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |