C22H19FN2O3 — CID 167938320
3-[[(7-ethyl-2-oxochromen-4-yl)methylamino]methyl]-7-fluoro-1H-quinolin-2-one (PubChem CID 167938320) has the molecular formula C22H19FN2O3 and a molecular weight of 378.40 g/mol. Its IUPAC name is 3-[[(7-ethyl-2-oxochromen-4-yl)methylamino]methyl]-7-fluoro-1H-quinolin-2-one.
| Compound Name | 3-[[(7-ethyl-2-oxochromen-4-yl)methylamino]methyl]-7-fluoro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 167938320 |
| Molecular Formula | C22H19FN2O3 |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 3-[[(7-ethyl-2-oxochromen-4-yl)methylamino]methyl]-7-fluoro-1H-quinolin-2-one |
| SMILES | CCc1ccc2c(CNCc3cc4ccc(F)cc4[nH]c3=O)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H19FN2O3/c1-2-13-3-6-18-15(9-21(26)28-20(18)7-13)11-24-12-16-8-14-4-5-17(23)10-19(14)25-22(16)27/h3-10,24H,2,11-12H2,1H3,(H,25,27) |
| InChIKey | HLCLXHVTSXDZOQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 75.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|