C20H21NO3 — CID 9256149
7-ethyl-4-[(2-phenoxyethylamino)methyl]chromen-2-one (PubChem CID 9256149) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 7-ethyl-4-[(2-phenoxyethylamino)methyl]chromen-2-one.
| Compound Name | 7-ethyl-4-[(2-phenoxyethylamino)methyl]chromen-2-one |
|---|---|
| PubChem CID | 9256149 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 7-ethyl-4-[(2-phenoxyethylamino)methyl]chromen-2-one |
| SMILES | CCc1ccc2c(CNCCOc3ccccc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C20H21NO3/c1-2-15-8-9-18-16(13-20(22)24-19(18)12-15)14-21-10-11-23-17-6-4-3-5-7-17/h3-9,12-13,21H,2,10-11,14H2,1H3 |
| InChIKey | UUUOGOXMCFHHEE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|