C17H14F2N2O4S — CID 123303875
6-fluoro-3-[[2-fluoro-3-(sulfamoylamino)phenyl]methyl]-4-methyl-2-oxochromene (PubChem CID 123303875) has the molecular formula C17H14F2N2O4S and a molecular weight of 380.37 g/mol. Its IUPAC name is 6-fluoro-3-[[2-fluoro-3-(sulfamoylamino)phenyl]methyl]-4-methyl-2-oxochromene.
| Compound Name | 6-fluoro-3-[[2-fluoro-3-(sulfamoylamino)phenyl]methyl]-4-methyl-2-oxochromene |
|---|---|
| PubChem CID | 123303875 |
| Molecular Formula | C17H14F2N2O4S |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 6-fluoro-3-[[2-fluoro-3-(sulfamoylamino)phenyl]methyl]-4-methyl-2-oxochromene |
| SMILES | Cc1c(Cc2cccc(NS(N)(=O)=O)c2F)c(=O)oc2ccc(F)cc12 |
| InChI | InChI=1S/C17H14F2N2O4S/c1-9-12-8-11(18)5-6-15(12)25-17(22)13(9)7-10-3-2-4-14(16(10)19)21-26(20,23)24/h2-6,8,21H,7H2,1H3,(H2,20,23,24) |
| InChIKey | WXWBBJDYKMLLDJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|