C25H20FN3O5S2 — CID 24753149
7-(1,3-benzothiazol-2-yloxy)-3-[[2-fluoro-3-(methylsulfamoylamino)phenyl]methyl]-4-methylchromen-2-one (PubChem CID 24753149) has the molecular formula C25H20FN3O5S2 and a molecular weight of 525.58 g/mol. Its IUPAC name is 7-(1,3-benzothiazol-2-yloxy)-3-[[2-fluoro-3-(methylsulfamoylamino)phenyl]methyl]-4-methylchromen-2-one.
| Compound Name | 7-(1,3-benzothiazol-2-yloxy)-3-[[2-fluoro-3-(methylsulfamoylamino)phenyl]methyl]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 24753149 |
| Molecular Formula | C25H20FN3O5S2 |
| Molecular Weight | 525.58 g/mol |
| Exact Mass | 525.08 |
| IUPAC Name | 7-(1,3-benzothiazol-2-yloxy)-3-[[2-fluoro-3-(methylsulfamoylamino)phenyl]methyl]-4-methylchromen-2-one |
| SMILES | CNS(=O)(=O)Nc1cccc(Cc2c(C)c3ccc(Oc4nc5ccccc5s4)cc3oc2=O)c1F |
| InChI | InChI=1S/C25H20FN3O5S2/c1-14-17-11-10-16(33-25-28-19-7-3-4-9-22(19)35-25)13-21(17)34-24(30)18(14)12-15-6-5-8-20(23(15)26)29-36(31,32)27-2/h3-11,13,27,29H,12H2,1-2H3 |
| InChIKey | CPBPCNVOEWWUKZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.58 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|