C26H22FN3O3S2 — CID 143523142
7-(4H-3,1-benzothiazin-2-yloxy)-3-[[2-fluoro-3-(methylaminosulfanylamino)phenyl]methyl]-4-methylchromen-2-one (PubChem CID 143523142) has the molecular formula C26H22FN3O3S2 and a molecular weight of 507.61 g/mol. Its IUPAC name is 7-(4H-3,1-benzothiazin-2-yloxy)-3-[[2-fluoro-3-(methylaminosulfanylamino)phenyl]methyl]-4-methylchromen-2-one.
| Compound Name | 7-(4H-3,1-benzothiazin-2-yloxy)-3-[[2-fluoro-3-(methylaminosulfanylamino)phenyl]methyl]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 143523142 |
| Molecular Formula | C26H22FN3O3S2 |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | 7-(4H-3,1-benzothiazin-2-yloxy)-3-[[2-fluoro-3-(methylaminosulfanylamino)phenyl]methyl]-4-methylchromen-2-one |
| SMILES | CNSNc1cccc(Cc2c(C)c3ccc(OC4=Nc5ccccc5CS4)cc3oc2=O)c1F |
| InChI | InChI=1S/C26H22FN3O3S2/c1-15-19-11-10-18(32-26-29-21-8-4-3-6-17(21)14-34-26)13-23(19)33-25(31)20(15)12-16-7-5-9-22(24(16)27)30-35-28-2/h3-11,13,28,30H,12,14H2,1-2H3 |
| InChIKey | KCNBIKSAEAXJIG-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|