C27H26BFN2O5 — CID 169262667
3-[[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-4-methyl-7-pyrimidin-2-yloxychromen-2-one (PubChem CID 169262667) has the molecular formula C27H26BFN2O5 and a molecular weight of 488.32 g/mol. Its IUPAC name is 3-[[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-4-methyl-7-pyrimidin-2-yloxychromen-2-one.
| Compound Name | 3-[[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-4-methyl-7-pyrimidin-2-yloxychromen-2-one |
|---|---|
| PubChem CID | 169262667 |
| Molecular Formula | C27H26BFN2O5 |
| Molecular Weight | 488.32 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 3-[[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-4-methyl-7-pyrimidin-2-yloxychromen-2-one |
| SMILES | Cc1c(Cc2cccc(B3OC(C)(C)C(C)(C)O3)c2F)c(=O)oc2cc(Oc3ncccn3)ccc12 |
| InChI | InChI=1S/C27H26BFN2O5/c1-16-19-11-10-18(33-25-30-12-7-13-31-25)15-22(19)34-24(32)20(16)14-17-8-6-9-21(23(17)29)28-35-26(2,3)27(4,5)36-28/h6-13,15H,14H2,1-5H3 |
| InChIKey | XUVFXXZSISXJGS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 83.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.32 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|