C22H22FN3O4S2 — CID 143523054
ethane;2-[3-[[2-fluoro-3-(sulfinamoylamino)phenyl]methyl]-4-methyl-2-oxochromen-7-yl]oxy-1,3-thiazole (PubChem CID 143523054) has the molecular formula C22H22FN3O4S2 and a molecular weight of 475.57 g/mol. Its IUPAC name is ethane;2-[3-[[2-fluoro-3-(sulfinamoylamino)phenyl]methyl]-4-methyl-2-oxochromen-7-yl]oxy-1,3-thiazole.
| Compound Name | ethane;2-[3-[[2-fluoro-3-(sulfinamoylamino)phenyl]methyl]-4-methyl-2-oxochromen-7-yl]oxy-1,3-thiazole |
|---|---|
| PubChem CID | 143523054 |
| Molecular Formula | C22H22FN3O4S2 |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | ethane;2-[3-[[2-fluoro-3-(sulfinamoylamino)phenyl]methyl]-4-methyl-2-oxochromen-7-yl]oxy-1,3-thiazole |
| SMILES | CC.Cc1c(Cc2cccc(NS(N)=O)c2F)c(=O)oc2cc(Oc3nccs3)ccc12 |
| InChI | InChI=1S/C20H16FN3O4S2.C2H6/c1-11-14-6-5-13(27-20-23-7-8-29-20)10-17(14)28-19(25)15(11)9-12-3-2-4-16(18(12)21)24-30(22)26;1-2/h2-8,10,24H,9,22H2,1H3;1-2H3 |
| InChIKey | JNFQPBLXRHZJHA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|