C22H19N3O6S2 — CID 59139431
2-[[3-[[4-methyl-2-oxo-7-(1,3-thiazol-2-yloxy)chromen-3-yl]methyl]phenyl]sulfamoyl]acetamide (PubChem CID 59139431) has the molecular formula C22H19N3O6S2 and a molecular weight of 485.54 g/mol. Its IUPAC name is 2-[[3-[[4-methyl-2-oxo-7-(1,3-thiazol-2-yloxy)chromen-3-yl]methyl]phenyl]sulfamoyl]acetamide.
| Compound Name | 2-[[3-[[4-methyl-2-oxo-7-(1,3-thiazol-2-yloxy)chromen-3-yl]methyl]phenyl]sulfamoyl]acetamide |
|---|---|
| PubChem CID | 59139431 |
| Molecular Formula | C22H19N3O6S2 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | 2-[[3-[[4-methyl-2-oxo-7-(1,3-thiazol-2-yloxy)chromen-3-yl]methyl]phenyl]sulfamoyl]acetamide |
| SMILES | Cc1c(Cc2cccc(NS(=O)(=O)CC(N)=O)c2)c(=O)oc2cc(Oc3nccs3)ccc12 |
| InChI | InChI=1S/C22H19N3O6S2/c1-13-17-6-5-16(30-22-24-7-8-32-22)11-19(17)31-21(27)18(13)10-14-3-2-4-15(9-14)25-33(28,29)12-20(23)26/h2-9,11,25H,10,12H2,1H3,(H2,23,26) |
| InChIKey | WBPOOLNGJIFYRH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 141.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|