C21H18FKN3O5S2 — CID 161399438
CID 161399438 (PubChem CID 161399438) has the molecular formula C21H18FKN3O5S2 and a molecular weight of 514.62 g/mol.
| Compound Name | CID 161399438 |
|---|---|
| PubChem CID | 161399438 |
| Molecular Formula | C21H18FKN3O5S2 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.03 |
| IUPAC Name | — |
| SMILES | CNS(=O)(=O)c1cccc(C(N)c2c(C)c3ccc(Oc4nccs4)cc3oc2=O)c1F.[K] |
| InChI | InChI=1S/C21H18FN3O5S2.K/c1-11-13-7-6-12(29-21-25-8-9-31-21)10-15(13)30-20(26)17(11)19(23)14-4-3-5-16(18(14)22)32(27,28)24-2;/h3-10,19,24H,23H2,1-2H3; |
| InChIKey | RRUDRPBXGGJGBM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|