C19H14F2N4O5S2 — CID 87181122
2-[6-fluoro-3-[[3-fluoro-2-(sulfamoylamino)-4-pyridinyl]methyl]-4-methyl-2-oxochromen-7-yl]oxy-1,3-thiazole (PubChem CID 87181122) has the molecular formula C19H14F2N4O5S2 and a molecular weight of 480.47 g/mol. Its IUPAC name is 2-[6-fluoro-3-[[3-fluoro-2-(sulfamoylamino)-4-pyridinyl]methyl]-4-methyl-2-oxochromen-7-yl]oxy-1,3-thiazole.
| Compound Name | 2-[6-fluoro-3-[[3-fluoro-2-(sulfamoylamino)-4-pyridinyl]methyl]-4-methyl-2-oxochromen-7-yl]oxy-1,3-thiazole |
|---|---|
| PubChem CID | 87181122 |
| Molecular Formula | C19H14F2N4O5S2 |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | 2-[6-fluoro-3-[[3-fluoro-2-(sulfamoylamino)-4-pyridinyl]methyl]-4-methyl-2-oxochromen-7-yl]oxy-1,3-thiazole |
| SMILES | Cc1c(Cc2ccnc(NS(N)(=O)=O)c2F)c(=O)oc2cc(Oc3nccs3)c(F)cc12 |
| InChI | InChI=1S/C19H14F2N4O5S2/c1-9-11-7-13(20)15(30-19-24-4-5-31-19)8-14(11)29-18(26)12(9)6-10-2-3-23-17(16(10)21)25-32(22,27)28/h2-5,7-8H,6H2,1H3,(H,23,25)(H2,22,27,28) |
| InChIKey | OIOTUVGYBNEQJA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 137.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|