C20H20FN3O5S — CID 169262607
7-cyclopropyloxy-3-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]-4-methylchromen-2-one (PubChem CID 169262607) has the molecular formula C20H20FN3O5S and a molecular weight of 433.46 g/mol. Its IUPAC name is 7-cyclopropyloxy-3-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]-4-methylchromen-2-one.
| Compound Name | 7-cyclopropyloxy-3-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 169262607 |
| Molecular Formula | C20H20FN3O5S |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 7-cyclopropyloxy-3-[[3-fluoro-2-(methylsulfamoylamino)-4-pyridinyl]methyl]-4-methylchromen-2-one |
| SMILES | CNS(=O)(=O)Nc1nccc(Cc2c(C)c3ccc(OC4CC4)cc3oc2=O)c1F |
| InChI | InChI=1S/C20H20FN3O5S/c1-11-15-6-5-14(28-13-3-4-13)10-17(15)29-20(25)16(11)9-12-7-8-23-19(18(12)21)24-30(26,27)22-2/h5-8,10,13,22H,3-4,9H2,1-2H3,(H,23,24) |
| InChIKey | CKRMSVHNZDTLLD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|