C22H20FN5O5S — CID 178170868
3-[3-[[2-(dimethylsulfamoylamino)-3-fluoro-4-pyridinyl]methyl]-4-methyl-2-oxochromen-7-yl]oxypyridazine (PubChem CID 178170868) has the molecular formula C22H20FN5O5S and a molecular weight of 485.50 g/mol. Its IUPAC name is 3-[3-[[2-(dimethylsulfamoylamino)-3-fluoro-4-pyridinyl]methyl]-4-methyl-2-oxochromen-7-yl]oxypyridazine.
| Compound Name | 3-[3-[[2-(dimethylsulfamoylamino)-3-fluoro-4-pyridinyl]methyl]-4-methyl-2-oxochromen-7-yl]oxypyridazine |
|---|---|
| PubChem CID | 178170868 |
| Molecular Formula | C22H20FN5O5S |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 3-[3-[[2-(dimethylsulfamoylamino)-3-fluoro-4-pyridinyl]methyl]-4-methyl-2-oxochromen-7-yl]oxypyridazine |
| SMILES | Cc1c(Cc2ccnc(NS(=O)(=O)N(C)C)c2F)c(=O)oc2cc(Oc3cccnn3)ccc12 |
| InChI | InChI=1S/C22H20FN5O5S/c1-13-16-7-6-15(32-19-5-4-9-25-26-19)12-18(16)33-22(29)17(13)11-14-8-10-24-21(20(14)23)27-34(30,31)28(2)3/h4-10,12H,11H2,1-3H3,(H,24,27) |
| InChIKey | JBYNKVWZXLCKGB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 127.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|