C24H19F2NO5S — CID 169262626
3-[[2-fluoro-3-(methylsulfonylmethyl)phenyl]methyl]-7-[(3-fluoro-2-pyridinyl)oxy]-4-methylchromen-2-one (PubChem CID 169262626) has the molecular formula C24H19F2NO5S and a molecular weight of 471.48 g/mol. Its IUPAC name is 3-[[2-fluoro-3-(methylsulfonylmethyl)phenyl]methyl]-7-[(3-fluoro-2-pyridinyl)oxy]-4-methylchromen-2-one.
| Compound Name | 3-[[2-fluoro-3-(methylsulfonylmethyl)phenyl]methyl]-7-[(3-fluoro-2-pyridinyl)oxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 169262626 |
| Molecular Formula | C24H19F2NO5S |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 3-[[2-fluoro-3-(methylsulfonylmethyl)phenyl]methyl]-7-[(3-fluoro-2-pyridinyl)oxy]-4-methylchromen-2-one |
| SMILES | Cc1c(Cc2cccc(CS(C)(=O)=O)c2F)c(=O)oc2cc(Oc3ncccc3F)ccc12 |
| InChI | InChI=1S/C24H19F2NO5S/c1-14-18-9-8-17(31-23-20(25)7-4-10-27-23)12-21(18)32-24(28)19(14)11-15-5-3-6-16(22(15)26)13-33(2,29)30/h3-10,12H,11,13H2,1-2H3 |
| InChIKey | JPLZUVPJPTUOSM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 86.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|