C26H25F2N3O6S — CID 172566128
4-ethyl-3-[[2-fluoro-3-(2-methoxyethylsulfamoylamino)phenyl]methyl]-7-[(3-fluoro-2-pyridinyl)oxy]chromen-2-one (PubChem CID 172566128) has the molecular formula C26H25F2N3O6S and a molecular weight of 545.56 g/mol. Its IUPAC name is 4-ethyl-3-[[2-fluoro-3-(2-methoxyethylsulfamoylamino)phenyl]methyl]-7-[(3-fluoro-2-pyridinyl)oxy]chromen-2-one.
| Compound Name | 4-ethyl-3-[[2-fluoro-3-(2-methoxyethylsulfamoylamino)phenyl]methyl]-7-[(3-fluoro-2-pyridinyl)oxy]chromen-2-one |
|---|---|
| PubChem CID | 172566128 |
| Molecular Formula | C26H25F2N3O6S |
| Molecular Weight | 545.56 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | 4-ethyl-3-[[2-fluoro-3-(2-methoxyethylsulfamoylamino)phenyl]methyl]-7-[(3-fluoro-2-pyridinyl)oxy]chromen-2-one |
| SMILES | CCc1c(Cc2cccc(NS(=O)(=O)NCCOC)c2F)c(=O)oc2cc(Oc3ncccc3F)ccc12 |
| InChI | InChI=1S/C26H25F2N3O6S/c1-3-18-19-10-9-17(36-25-21(27)7-5-11-29-25)15-23(19)37-26(32)20(18)14-16-6-4-8-22(24(16)28)31-38(33,34)30-12-13-35-2/h4-11,15,30-31H,3,12-14H2,1-2H3 |
| InChIKey | XNOZMELRAIGMCX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 119.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.56 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|