C20H18FN3O5S2 — CID 88984077
2-[3-[[2-fluoro-3-(sulfamoylamino)phenyl]methyl]-4-methyl-2-oxochromen-7-yl]oxy-4,5-dihydro-1,3-thiazole (PubChem CID 88984077) has the molecular formula C20H18FN3O5S2 and a molecular weight of 463.51 g/mol. Its IUPAC name is 2-[3-[[2-fluoro-3-(sulfamoylamino)phenyl]methyl]-4-methyl-2-oxochromen-7-yl]oxy-4,5-dihydro-1,3-thiazole.
| Compound Name | 2-[3-[[2-fluoro-3-(sulfamoylamino)phenyl]methyl]-4-methyl-2-oxochromen-7-yl]oxy-4,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 88984077 |
| Molecular Formula | C20H18FN3O5S2 |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | 2-[3-[[2-fluoro-3-(sulfamoylamino)phenyl]methyl]-4-methyl-2-oxochromen-7-yl]oxy-4,5-dihydro-1,3-thiazole |
| SMILES | Cc1c(Cc2cccc(NS(N)(=O)=O)c2F)c(=O)oc2cc(OC3=NCCS3)ccc12 |
| InChI | InChI=1S/C20H18FN3O5S2/c1-11-14-6-5-13(28-20-23-7-8-30-20)10-17(14)29-19(25)15(11)9-12-3-2-4-16(18(12)21)24-31(22,26)27/h2-6,10,24H,7-9H2,1H3,(H2,22,26,27) |
| InChIKey | SWHZVZIFWRVDKG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|