C20H20FN3O6S — CID 89233752
[3-[[2-fluoro-3-(methylsulfamoylamino)phenyl]methyl]-4-methyl-2-oxochromen-7-yl] N-methylcarbamate (PubChem CID 89233752) has the molecular formula C20H20FN3O6S and a molecular weight of 449.46 g/mol. Its IUPAC name is [3-[[2-fluoro-3-(methylsulfamoylamino)phenyl]methyl]-4-methyl-2-oxochromen-7-yl] N-methylcarbamate.
| Compound Name | [3-[[2-fluoro-3-(methylsulfamoylamino)phenyl]methyl]-4-methyl-2-oxochromen-7-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 89233752 |
| Molecular Formula | C20H20FN3O6S |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | [3-[[2-fluoro-3-(methylsulfamoylamino)phenyl]methyl]-4-methyl-2-oxochromen-7-yl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1ccc2c(C)c(Cc3cccc(NS(=O)(=O)NC)c3F)c(=O)oc2c1 |
| InChI | InChI=1S/C20H20FN3O6S/c1-11-14-8-7-13(29-20(26)22-2)10-17(14)30-19(25)15(11)9-12-5-4-6-16(18(12)21)24-31(27,28)23-3/h4-8,10,23-24H,9H2,1-3H3,(H,22,26) |
| InChIKey | FARNTJCSPWWGFO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|