C24H18F2N2O5S — CID 169262664
N-[2-fluoro-3-[[7-[(3-fluoro-2-pyridinyl)oxy]-4-methyl-2-oxochromen-3-yl]methyl]phenyl]ethenesulfonamide (PubChem CID 169262664) has the molecular formula C24H18F2N2O5S and a molecular weight of 484.48 g/mol. Its IUPAC name is N-[2-fluoro-3-[[7-[(3-fluoro-2-pyridinyl)oxy]-4-methyl-2-oxochromen-3-yl]methyl]phenyl]ethenesulfonamide.
| Compound Name | N-[2-fluoro-3-[[7-[(3-fluoro-2-pyridinyl)oxy]-4-methyl-2-oxochromen-3-yl]methyl]phenyl]ethenesulfonamide |
|---|---|
| PubChem CID | 169262664 |
| Molecular Formula | C24H18F2N2O5S |
| Molecular Weight | 484.48 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | N-[2-fluoro-3-[[7-[(3-fluoro-2-pyridinyl)oxy]-4-methyl-2-oxochromen-3-yl]methyl]phenyl]ethenesulfonamide |
| SMILES | C=CS(=O)(=O)Nc1cccc(Cc2c(C)c3ccc(Oc4ncccc4F)cc3oc2=O)c1F |
| InChI | InChI=1S/C24H18F2N2O5S/c1-3-34(30,31)28-20-8-4-6-15(22(20)26)12-18-14(2)17-10-9-16(13-21(17)33-24(18)29)32-23-19(25)7-5-11-27-23/h3-11,13,28H,1,12H2,2H3 |
| InChIKey | KJNQRRVEFLOBLL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|