C21H18FN5O3S — CID 129259938
3-[[3-fluoro-2-(methylaminosulfanylamino)-4-pyridinyl]methyl]-4-methyl-7-pyrimidin-2-yloxychromen-2-one (PubChem CID 129259938) has the molecular formula C21H18FN5O3S and a molecular weight of 439.47 g/mol. Its IUPAC name is 3-[[3-fluoro-2-(methylaminosulfanylamino)-4-pyridinyl]methyl]-4-methyl-7-pyrimidin-2-yloxychromen-2-one.
| Compound Name | 3-[[3-fluoro-2-(methylaminosulfanylamino)-4-pyridinyl]methyl]-4-methyl-7-pyrimidin-2-yloxychromen-2-one |
|---|---|
| PubChem CID | 129259938 |
| Molecular Formula | C21H18FN5O3S |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 3-[[3-fluoro-2-(methylaminosulfanylamino)-4-pyridinyl]methyl]-4-methyl-7-pyrimidin-2-yloxychromen-2-one |
| SMILES | CNSNc1nccc(Cc2c(C)c3ccc(Oc4ncccn4)cc3oc2=O)c1F |
| InChI | InChI=1S/C21H18FN5O3S/c1-12-15-5-4-14(29-21-25-7-3-8-26-21)11-17(15)30-20(28)16(12)10-13-6-9-24-19(18(13)22)27-31-23-2/h3-9,11,23H,10H2,1-2H3,(H,24,27) |
| InChIKey | YKDRZRYVTGUGBM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|