C22H18F2N4O2S — CID 169262604
3-[[3-fluoro-2-(methylaminosulfanylamino)-4-pyridinyl]methyl]-7-(3-fluoro-2-pyridinyl)-4-methylchromen-2-one (PubChem CID 169262604) has the molecular formula C22H18F2N4O2S and a molecular weight of 440.48 g/mol. Its IUPAC name is 3-[[3-fluoro-2-(methylaminosulfanylamino)-4-pyridinyl]methyl]-7-(3-fluoro-2-pyridinyl)-4-methylchromen-2-one.
| Compound Name | 3-[[3-fluoro-2-(methylaminosulfanylamino)-4-pyridinyl]methyl]-7-(3-fluoro-2-pyridinyl)-4-methylchromen-2-one |
|---|---|
| PubChem CID | 169262604 |
| Molecular Formula | C22H18F2N4O2S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 3-[[3-fluoro-2-(methylaminosulfanylamino)-4-pyridinyl]methyl]-7-(3-fluoro-2-pyridinyl)-4-methylchromen-2-one |
| SMILES | CNSNc1nccc(Cc2c(C)c3ccc(-c4ncccc4F)cc3oc2=O)c1F |
| InChI | InChI=1S/C22H18F2N4O2S/c1-12-15-6-5-14(20-17(23)4-3-8-26-20)11-18(15)30-22(29)16(12)10-13-7-9-27-21(19(13)24)28-31-25-2/h3-9,11,25H,10H2,1-2H3,(H,27,28) |
| InChIKey | XHIPYGMCVKIJLR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|