C22H25BrClFN4O4S — CID 169116478
[4-(bromomethyl)-6-chloro-3-[[3-fluoro-2-(methylaminosulfanylamino)-4-pyridinyl]methyl]-2-oxochromen-7-yl] N,N-dimethylcarbamate;ethane (PubChem CID 169116478) has the molecular formula C22H25BrClFN4O4S and a molecular weight of 575.89 g/mol. Its IUPAC name is [4-(bromomethyl)-6-chloro-3-[[3-fluoro-2-(methylaminosulfanylamino)-4-pyridinyl]methyl]-2-oxochromen-7-yl] N,N-dimethylcarbamate;ethane.
| Compound Name | [4-(bromomethyl)-6-chloro-3-[[3-fluoro-2-(methylaminosulfanylamino)-4-pyridinyl]methyl]-2-oxochromen-7-yl] N,N-dimethylcarbamate;ethane |
|---|---|
| PubChem CID | 169116478 |
| Molecular Formula | C22H25BrClFN4O4S |
| Molecular Weight | 575.89 g/mol |
| Exact Mass | 574.05 |
| IUPAC Name | [4-(bromomethyl)-6-chloro-3-[[3-fluoro-2-(methylaminosulfanylamino)-4-pyridinyl]methyl]-2-oxochromen-7-yl] N,N-dimethylcarbamate;ethane |
| SMILES | CC.CNSNc1nccc(Cc2c(CBr)c3cc(Cl)c(OC(=O)N(C)C)cc3oc2=O)c1F |
| InChI | InChI=1S/C20H19BrClFN4O4S.C2H6/c1-24-32-26-18-17(23)10(4-5-25-18)6-12-13(9-21)11-7-14(22)16(31-20(29)27(2)3)8-15(11)30-19(12)28;1-2/h4-5,7-8,24H,6,9H2,1-3H3,(H,25,26);1-2H3 |
| InChIKey | LGFPFGDPCYVADC-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.89 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|