C21H17F2N5O3S — CID 143749837
3-[[3-fluoro-2-(methylaminosulfanylamino)-4-pyridinyl]methyl]-7-(5-fluoropyrimidin-2-yl)oxy-4-methylchromen-2-one (PubChem CID 143749837) has the molecular formula C21H17F2N5O3S and a molecular weight of 457.46 g/mol. Its IUPAC name is 3-[[3-fluoro-2-(methylaminosulfanylamino)-4-pyridinyl]methyl]-7-(5-fluoropyrimidin-2-yl)oxy-4-methylchromen-2-one.
| Compound Name | 3-[[3-fluoro-2-(methylaminosulfanylamino)-4-pyridinyl]methyl]-7-(5-fluoropyrimidin-2-yl)oxy-4-methylchromen-2-one |
|---|---|
| PubChem CID | 143749837 |
| Molecular Formula | C21H17F2N5O3S |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 3-[[3-fluoro-2-(methylaminosulfanylamino)-4-pyridinyl]methyl]-7-(5-fluoropyrimidin-2-yl)oxy-4-methylchromen-2-one |
| SMILES | CNSNc1nccc(Cc2c(C)c3ccc(Oc4ncc(F)cn4)cc3oc2=O)c1F |
| InChI | InChI=1S/C21H17F2N5O3S/c1-11-15-4-3-14(30-21-26-9-13(22)10-27-21)8-17(15)31-20(29)16(11)7-12-5-6-25-19(18(12)23)28-32-24-2/h3-6,8-10,24H,7H2,1-2H3,(H,25,28) |
| InChIKey | ONFVJVBDPSDDDD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|