C22H19ClN2O8 — CID 58102276
methyl 2-[6-chloro-7-(dimethylcarbamoyloxy)-3-[(3-nitrophenyl)methyl]-2-oxochromen-4-yl]acetate (PubChem CID 58102276) has the molecular formula C22H19ClN2O8 and a molecular weight of 474.85 g/mol. Its IUPAC name is methyl 2-[6-chloro-7-(dimethylcarbamoyloxy)-3-[(3-nitrophenyl)methyl]-2-oxochromen-4-yl]acetate.
| Compound Name | methyl 2-[6-chloro-7-(dimethylcarbamoyloxy)-3-[(3-nitrophenyl)methyl]-2-oxochromen-4-yl]acetate |
|---|---|
| PubChem CID | 58102276 |
| Molecular Formula | C22H19ClN2O8 |
| Molecular Weight | 474.85 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | methyl 2-[6-chloro-7-(dimethylcarbamoyloxy)-3-[(3-nitrophenyl)methyl]-2-oxochromen-4-yl]acetate |
| SMILES | COC(=O)Cc1c(Cc2cccc([N+](=O)[O-])c2)c(=O)oc2cc(OC(=O)N(C)C)c(Cl)cc12 |
| InChI | InChI=1S/C22H19ClN2O8/c1-24(2)22(28)33-19-11-18-15(9-17(19)23)14(10-20(26)31-3)16(21(27)32-18)8-12-5-4-6-13(7-12)25(29)30/h4-7,9,11H,8,10H2,1-3H3 |
| InChIKey | KNJQIXNDJCVODV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 129.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.85 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|