C28H37ClN4O6S — CID 89288093
[3-[[3-[bis[1-(dimethylamino)ethyl]sulfamoyl]phenyl]methyl]-6-chloro-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate (PubChem CID 89288093) has the molecular formula C28H37ClN4O6S and a molecular weight of 593.15 g/mol. Its IUPAC name is [3-[[3-[bis[1-(dimethylamino)ethyl]sulfamoyl]phenyl]methyl]-6-chloro-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate.
| Compound Name | [3-[[3-[bis[1-(dimethylamino)ethyl]sulfamoyl]phenyl]methyl]-6-chloro-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 89288093 |
| Molecular Formula | C28H37ClN4O6S |
| Molecular Weight | 593.15 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | [3-[[3-[bis[1-(dimethylamino)ethyl]sulfamoyl]phenyl]methyl]-6-chloro-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate |
| SMILES | Cc1c(Cc2cccc(S(=O)(=O)N(C(C)N(C)C)C(C)N(C)C)c2)c(=O)oc2cc(OC(=O)N(C)C)c(Cl)cc12 |
| InChI | InChI=1S/C28H37ClN4O6S/c1-17-22-15-24(29)26(39-28(35)32(8)9)16-25(22)38-27(34)23(17)14-20-11-10-12-21(13-20)40(36,37)33(18(2)30(4)5)19(3)31(6)7/h10-13,15-16,18-19H,14H2,1-9H3 |
| InChIKey | YAFGKIOPQBFBJE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 103.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.15 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|