C23H28Cl2N4O6S — CID 162315601
2-[[3-[[6-chloro-7-(dimethylcarbamoyloxy)-4-methyl-2-oxochromen-3-yl]methyl]phenyl]sulfamoylamino]ethyl-methylazanium chloride (PubChem CID 162315601) has the molecular formula C23H28Cl2N4O6S and a molecular weight of 559.47 g/mol. Its IUPAC name is 2-[[3-[[6-chloro-7-(dimethylcarbamoyloxy)-4-methyl-2-oxochromen-3-yl]methyl]phenyl]sulfamoylamino]ethyl-methylazanium chloride.
| Compound Name | 2-[[3-[[6-chloro-7-(dimethylcarbamoyloxy)-4-methyl-2-oxochromen-3-yl]methyl]phenyl]sulfamoylamino]ethyl-methylazanium chloride |
|---|---|
| PubChem CID | 162315601 |
| Molecular Formula | C23H28Cl2N4O6S |
| Molecular Weight | 559.47 g/mol |
| Exact Mass | 558.11 |
| IUPAC Name | 2-[[3-[[6-chloro-7-(dimethylcarbamoyloxy)-4-methyl-2-oxochromen-3-yl]methyl]phenyl]sulfamoylamino]ethyl-methylazanium chloride |
| SMILES | C[NH2+]CCNS(=O)(=O)Nc1cccc(Cc2c(C)c3cc(Cl)c(OC(=O)N(C)C)cc3oc2=O)c1.[Cl-] |
| InChI | InChI=1S/C23H27ClN4O6S.ClH/c1-14-17-12-19(24)21(34-23(30)28(3)4)13-20(17)33-22(29)18(14)11-15-6-5-7-16(10-15)27-35(31,32)26-9-8-25-2;/h5-7,10,12-13,25-27H,8-9,11H2,1-4H3;1H |
| InChIKey | VJVNDSXZWRVFRY-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 134.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.47 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|