C23H25ClN2O7S — CID 89288034
[6-chloro-3-[[3-[1-hydroxyethyl(methyl)sulfamoyl]phenyl]methyl]-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate (PubChem CID 89288034) has the molecular formula C23H25ClN2O7S and a molecular weight of 508.98 g/mol. Its IUPAC name is [6-chloro-3-[[3-[1-hydroxyethyl(methyl)sulfamoyl]phenyl]methyl]-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate.
| Compound Name | [6-chloro-3-[[3-[1-hydroxyethyl(methyl)sulfamoyl]phenyl]methyl]-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 89288034 |
| Molecular Formula | C23H25ClN2O7S |
| Molecular Weight | 508.98 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | [6-chloro-3-[[3-[1-hydroxyethyl(methyl)sulfamoyl]phenyl]methyl]-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate |
| SMILES | Cc1c(Cc2cccc(S(=O)(=O)N(C)C(C)O)c2)c(=O)oc2cc(OC(=O)N(C)C)c(Cl)cc12 |
| InChI | InChI=1S/C23H25ClN2O7S/c1-13-17-11-19(24)21(33-23(29)25(3)4)12-20(17)32-22(28)18(13)10-15-7-6-8-16(9-15)34(30,31)26(5)14(2)27/h6-9,11-12,14,27H,10H2,1-5H3 |
| InChIKey | JGAZAVLFAJERKP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.98 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|