C25H27ClFN3O9S — CID 86637666
tert-butyl [[3-[[6-chloro-7-(dimethylcarbamoyloxy)-4-(fluoromethyl)-2-oxochromen-3-yl]methyl]phenyl]sulfamoylamino] carbonate (PubChem CID 86637666) has the molecular formula C25H27ClFN3O9S and a molecular weight of 600.02 g/mol. Its IUPAC name is tert-butyl [[3-[[6-chloro-7-(dimethylcarbamoyloxy)-4-(fluoromethyl)-2-oxochromen-3-yl]methyl]phenyl]sulfamoylamino] carbonate.
| Compound Name | tert-butyl [[3-[[6-chloro-7-(dimethylcarbamoyloxy)-4-(fluoromethyl)-2-oxochromen-3-yl]methyl]phenyl]sulfamoylamino] carbonate |
|---|---|
| PubChem CID | 86637666 |
| Molecular Formula | C25H27ClFN3O9S |
| Molecular Weight | 600.02 g/mol |
| Exact Mass | 599.11 |
| IUPAC Name | tert-butyl [[3-[[6-chloro-7-(dimethylcarbamoyloxy)-4-(fluoromethyl)-2-oxochromen-3-yl]methyl]phenyl]sulfamoylamino] carbonate |
| SMILES | CN(C)C(=O)Oc1cc2oc(=O)c(Cc3cccc(NS(=O)(=O)NOC(=O)OC(C)(C)C)c3)c(CF)c2cc1Cl |
| InChI | InChI=1S/C25H27ClFN3O9S/c1-25(2,3)38-24(33)39-29-40(34,35)28-15-8-6-7-14(9-15)10-17-18(13-27)16-11-19(26)21(37-23(32)30(4)5)12-20(16)36-22(17)31/h6-9,11-12,28-29H,10,13H2,1-5H3 |
| InChIKey | VZTBQQIRFWSEKE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 153.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.02 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|