C21H22FN3O6S — CID 24753784
[3-[[2-fluoro-3-(methylsulfamoylamino)phenyl]methyl]-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate (PubChem CID 24753784) has the molecular formula C21H22FN3O6S and a molecular weight of 463.49 g/mol. Its IUPAC name is [3-[[2-fluoro-3-(methylsulfamoylamino)phenyl]methyl]-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate.
| Compound Name | [3-[[2-fluoro-3-(methylsulfamoylamino)phenyl]methyl]-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 24753784 |
| Molecular Formula | C21H22FN3O6S |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | [3-[[2-fluoro-3-(methylsulfamoylamino)phenyl]methyl]-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate |
| SMILES | CNS(=O)(=O)Nc1cccc(Cc2c(C)c3ccc(OC(=O)N(C)C)cc3oc2=O)c1F |
| InChI | InChI=1S/C21H22FN3O6S/c1-12-15-9-8-14(30-21(27)25(3)4)11-18(15)31-20(26)16(12)10-13-6-5-7-17(19(13)22)24-32(28,29)23-2/h5-9,11,23-24H,10H2,1-4H3 |
| InChIKey | YNVNIRFMFCJWSQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|