C23H23ClN4O6S — CID 24754132
[6-chloro-3-[[3-(2-cyanoethylsulfamoylamino)phenyl]methyl]-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate (PubChem CID 24754132) has the molecular formula C23H23ClN4O6S and a molecular weight of 518.98 g/mol. Its IUPAC name is [6-chloro-3-[[3-(2-cyanoethylsulfamoylamino)phenyl]methyl]-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate.
| Compound Name | [6-chloro-3-[[3-(2-cyanoethylsulfamoylamino)phenyl]methyl]-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 24754132 |
| Molecular Formula | C23H23ClN4O6S |
| Molecular Weight | 518.98 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | [6-chloro-3-[[3-(2-cyanoethylsulfamoylamino)phenyl]methyl]-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate |
| SMILES | Cc1c(Cc2cccc(NS(=O)(=O)NCCC#N)c2)c(=O)oc2cc(OC(=O)N(C)C)c(Cl)cc12 |
| InChI | InChI=1S/C23H23ClN4O6S/c1-14-17-12-19(24)21(34-23(30)28(2)3)13-20(17)33-22(29)18(14)11-15-6-4-7-16(10-15)27-35(31,32)26-9-5-8-25/h4,6-7,10,12-13,26-27H,5,9,11H2,1-3H3 |
| InChIKey | GHJMMQHQACPFBT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 141.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.98 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|