C23H26N2O6 — CID 143523013
[4,6-dimethyl-3-[(3-nitrophenyl)methyl]-2-oxochromen-7-yl] N,N-dimethylcarbamate;ethane (PubChem CID 143523013) has the molecular formula C23H26N2O6 and a molecular weight of 426.47 g/mol. Its IUPAC name is [4,6-dimethyl-3-[(3-nitrophenyl)methyl]-2-oxochromen-7-yl] N,N-dimethylcarbamate;ethane.
| Compound Name | [4,6-dimethyl-3-[(3-nitrophenyl)methyl]-2-oxochromen-7-yl] N,N-dimethylcarbamate;ethane |
|---|---|
| PubChem CID | 143523013 |
| Molecular Formula | C23H26N2O6 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | [4,6-dimethyl-3-[(3-nitrophenyl)methyl]-2-oxochromen-7-yl] N,N-dimethylcarbamate;ethane |
| SMILES | CC.Cc1cc2c(C)c(Cc3cccc([N+](=O)[O-])c3)c(=O)oc2cc1OC(=O)N(C)C |
| InChI | InChI=1S/C21H20N2O6.C2H6/c1-12-8-16-13(2)17(10-14-6-5-7-15(9-14)23(26)27)20(24)28-19(16)11-18(12)29-21(25)22(3)4;1-2/h5-9,11H,10H2,1-4H3;1-2H3 |
| InChIKey | NWANGNQYUMNMAU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 102.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|