C23H23FN2O6S — CID 71491582
[3-[[3-(cyclopropylsulfamoyl)phenyl]methyl]-6-fluoro-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate (PubChem CID 71491582) has the molecular formula C23H23FN2O6S and a molecular weight of 474.51 g/mol. Its IUPAC name is [3-[[3-(cyclopropylsulfamoyl)phenyl]methyl]-6-fluoro-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate.
| Compound Name | [3-[[3-(cyclopropylsulfamoyl)phenyl]methyl]-6-fluoro-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 71491582 |
| Molecular Formula | C23H23FN2O6S |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | [3-[[3-(cyclopropylsulfamoyl)phenyl]methyl]-6-fluoro-4-methyl-2-oxochromen-7-yl] N,N-dimethylcarbamate |
| SMILES | Cc1c(Cc2cccc(S(=O)(=O)NC3CC3)c2)c(=O)oc2cc(OC(=O)N(C)C)c(F)cc12 |
| InChI | InChI=1S/C23H23FN2O6S/c1-13-17-11-19(24)21(32-23(28)26(2)3)12-20(17)31-22(27)18(13)10-14-5-4-6-16(9-14)33(29,30)25-15-7-8-15/h4-6,9,11-12,15,25H,7-8,10H2,1-3H3 |
| InChIKey | ZSFJQYPMTAFEMY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|