C19H13F2N3O3S — CID 178170919
3-[(2-amino-3-fluoro-4-pyridinyl)methyl]-7-[(5-fluoro-1,3-thiazol-4-yl)oxy]-4-methylchromen-2-one (PubChem CID 178170919) has the molecular formula C19H13F2N3O3S and a molecular weight of 401.39 g/mol. Its IUPAC name is 3-[(2-amino-3-fluoro-4-pyridinyl)methyl]-7-[(5-fluoro-1,3-thiazol-4-yl)oxy]-4-methylchromen-2-one.
| Compound Name | 3-[(2-amino-3-fluoro-4-pyridinyl)methyl]-7-[(5-fluoro-1,3-thiazol-4-yl)oxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 178170919 |
| Molecular Formula | C19H13F2N3O3S |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 3-[(2-amino-3-fluoro-4-pyridinyl)methyl]-7-[(5-fluoro-1,3-thiazol-4-yl)oxy]-4-methylchromen-2-one |
| SMILES | Cc1c(Cc2ccnc(N)c2F)c(=O)oc2cc(Oc3ncsc3F)ccc12 |
| InChI | InChI=1S/C19H13F2N3O3S/c1-9-12-3-2-11(26-18-16(21)28-8-24-18)7-14(12)27-19(25)13(9)6-10-4-5-23-17(22)15(10)20/h2-5,7-8H,6H2,1H3,(H2,22,23) |
| InChIKey | PXBZFIAQDWUDEK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|