C19H17F3N2O3 — CID 169262578
3-[(2-amino-3-fluoro-4-pyridinyl)methyl]-7-(2,2-difluoropropoxy)-4-methylchromen-2-one (PubChem CID 169262578) has the molecular formula C19H17F3N2O3 and a molecular weight of 378.35 g/mol. Its IUPAC name is 3-[(2-amino-3-fluoro-4-pyridinyl)methyl]-7-(2,2-difluoropropoxy)-4-methylchromen-2-one.
| Compound Name | 3-[(2-amino-3-fluoro-4-pyridinyl)methyl]-7-(2,2-difluoropropoxy)-4-methylchromen-2-one |
|---|---|
| PubChem CID | 169262578 |
| Molecular Formula | C19H17F3N2O3 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 3-[(2-amino-3-fluoro-4-pyridinyl)methyl]-7-(2,2-difluoropropoxy)-4-methylchromen-2-one |
| SMILES | Cc1c(Cc2ccnc(N)c2F)c(=O)oc2cc(OCC(C)(F)F)ccc12 |
| InChI | InChI=1S/C19H17F3N2O3/c1-10-13-4-3-12(26-9-19(2,21)22)8-15(13)27-18(25)14(10)7-11-5-6-24-17(23)16(11)20/h3-6,8H,7,9H2,1-2H3,(H2,23,24) |
| InChIKey | JMFXUWWYTXVUHT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|