C21H21N3O5S2 — CID 163624273
7-(2,3-dihydro-1,3-thiazol-2-yloxy)-4-methyl-3-[[3-(methylsulfamoylamino)phenyl]methyl]chromen-2-one (PubChem CID 163624273) has the molecular formula C21H21N3O5S2 and a molecular weight of 459.55 g/mol. Its IUPAC name is 7-(2,3-dihydro-1,3-thiazol-2-yloxy)-4-methyl-3-[[3-(methylsulfamoylamino)phenyl]methyl]chromen-2-one.
| Compound Name | 7-(2,3-dihydro-1,3-thiazol-2-yloxy)-4-methyl-3-[[3-(methylsulfamoylamino)phenyl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 163624273 |
| Molecular Formula | C21H21N3O5S2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | 7-(2,3-dihydro-1,3-thiazol-2-yloxy)-4-methyl-3-[[3-(methylsulfamoylamino)phenyl]methyl]chromen-2-one |
| SMILES | CNS(=O)(=O)Nc1cccc(Cc2c(C)c3ccc(OC4NC=CS4)cc3oc2=O)c1 |
| InChI | InChI=1S/C21H21N3O5S2/c1-13-17-7-6-16(28-21-23-8-9-30-21)12-19(17)29-20(25)18(13)11-14-4-3-5-15(10-14)24-31(26,27)22-2/h3-10,12,21-24H,11H2,1-2H3 |
| InChIKey | HQTDAARXWXCDNP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|