C20H18ClN3O4S — CID 123996361
3-[[3-[(6-chloro-4-methyl-2-oxochromen-3-yl)methyl]phenyl]sulfamoylamino]propanenitrile (PubChem CID 123996361) has the molecular formula C20H18ClN3O4S and a molecular weight of 431.90 g/mol. Its IUPAC name is 3-[[3-[(6-chloro-4-methyl-2-oxochromen-3-yl)methyl]phenyl]sulfamoylamino]propanenitrile.
| Compound Name | 3-[[3-[(6-chloro-4-methyl-2-oxochromen-3-yl)methyl]phenyl]sulfamoylamino]propanenitrile |
|---|---|
| PubChem CID | 123996361 |
| Molecular Formula | C20H18ClN3O4S |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | 3-[[3-[(6-chloro-4-methyl-2-oxochromen-3-yl)methyl]phenyl]sulfamoylamino]propanenitrile |
| SMILES | Cc1c(Cc2cccc(NS(=O)(=O)NCCC#N)c2)c(=O)oc2ccc(Cl)cc12 |
| InChI | InChI=1S/C20H18ClN3O4S/c1-13-17-12-15(21)6-7-19(17)28-20(25)18(13)11-14-4-2-5-16(10-14)24-29(26,27)23-9-3-8-22/h2,4-7,10,12,23-24H,3,9,11H2,1H3 |
| InChIKey | WKDLBUUUFZGLSB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|