C26H23N3O4S — CID 87181091
7-(3-cyanophenyl)-3-[[3-(dimethylsulfamoylamino)phenyl]methyl]-4-methyl-2-oxochromene (PubChem CID 87181091) has the molecular formula C26H23N3O4S and a molecular weight of 473.55 g/mol. Its IUPAC name is 7-(3-cyanophenyl)-3-[[3-(dimethylsulfamoylamino)phenyl]methyl]-4-methyl-2-oxochromene.
| Compound Name | 7-(3-cyanophenyl)-3-[[3-(dimethylsulfamoylamino)phenyl]methyl]-4-methyl-2-oxochromene |
|---|---|
| PubChem CID | 87181091 |
| Molecular Formula | C26H23N3O4S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 7-(3-cyanophenyl)-3-[[3-(dimethylsulfamoylamino)phenyl]methyl]-4-methyl-2-oxochromene |
| SMILES | Cc1c(Cc2cccc(NS(=O)(=O)N(C)C)c2)c(=O)oc2cc(-c3cccc(C#N)c3)ccc12 |
| InChI | InChI=1S/C26H23N3O4S/c1-17-23-11-10-21(20-8-4-7-19(12-20)16-27)15-25(23)33-26(30)24(17)14-18-6-5-9-22(13-18)28-34(31,32)29(2)3/h4-13,15,28H,14H2,1-3H3 |
| InChIKey | XSCRBVCPPDTVAG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|