C26H23N3O4S — CID 59139200
3-[[3-(dimethylsulfamoylamino)phenyl]methyl]-7-(3-isocyanophenyl)-4-methyl-2-oxochromene (PubChem CID 59139200) has the molecular formula C26H23N3O4S and a molecular weight of 473.55 g/mol. Its IUPAC name is 3-[[3-(dimethylsulfamoylamino)phenyl]methyl]-7-(3-isocyanophenyl)-4-methyl-2-oxochromene.
| Compound Name | 3-[[3-(dimethylsulfamoylamino)phenyl]methyl]-7-(3-isocyanophenyl)-4-methyl-2-oxochromene |
|---|---|
| PubChem CID | 59139200 |
| Molecular Formula | C26H23N3O4S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 3-[[3-(dimethylsulfamoylamino)phenyl]methyl]-7-(3-isocyanophenyl)-4-methyl-2-oxochromene |
| SMILES | [C-]#[N+]c1cccc(-c2ccc3c(C)c(Cc4cccc(NS(=O)(=O)N(C)C)c4)c(=O)oc3c2)c1 |
| InChI | InChI=1S/C26H23N3O4S/c1-17-23-12-11-20(19-8-6-9-21(15-19)27-2)16-25(23)33-26(30)24(17)14-18-7-5-10-22(13-18)28-34(31,32)29(3)4/h5-13,15-16,28H,14H2,1,3-4H3 |
| InChIKey | DDFCLUMVLIDZJR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|