C17H11Cl3O2 — CID 91543983
6-chloro-3-[(2,6-dichlorophenyl)methyl]-4-methylchromen-2-one (PubChem CID 91543983) has the molecular formula C17H11Cl3O2 and a molecular weight of 353.63 g/mol. Its IUPAC name is 6-chloro-3-[(2,6-dichlorophenyl)methyl]-4-methylchromen-2-one.
| Compound Name | 6-chloro-3-[(2,6-dichlorophenyl)methyl]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 91543983 |
| Molecular Formula | C17H11Cl3O2 |
| Molecular Weight | 353.63 g/mol |
| Exact Mass | 351.98 |
| IUPAC Name | 6-chloro-3-[(2,6-dichlorophenyl)methyl]-4-methylchromen-2-one |
| SMILES | Cc1c(Cc2c(Cl)cccc2Cl)c(=O)oc2ccc(Cl)cc12 |
| InChI | InChI=1S/C17H11Cl3O2/c1-9-11-7-10(18)5-6-16(11)22-17(21)12(9)8-13-14(19)3-2-4-15(13)20/h2-7H,8H2,1H3 |
| InChIKey | HSDCBRPUFDKFFU-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.63 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|