C20H19ClN2O3 — CID 123879794
2-[3-[(3-aminophenyl)methyl]-6-chloro-2-oxochromen-4-yl]-N,N-dimethylacetamide (PubChem CID 123879794) has the molecular formula C20H19ClN2O3 and a molecular weight of 370.84 g/mol. Its IUPAC name is 2-[3-[(3-aminophenyl)methyl]-6-chloro-2-oxochromen-4-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[3-[(3-aminophenyl)methyl]-6-chloro-2-oxochromen-4-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 123879794 |
| Molecular Formula | C20H19ClN2O3 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2-[3-[(3-aminophenyl)methyl]-6-chloro-2-oxochromen-4-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)Cc1c(Cc2cccc(N)c2)c(=O)oc2ccc(Cl)cc12 |
| InChI | InChI=1S/C20H19ClN2O3/c1-23(2)19(24)11-15-16-10-13(21)6-7-18(16)26-20(25)17(15)9-12-4-3-5-14(22)8-12/h3-8,10H,9,11,22H2,1-2H3 |
| InChIKey | WNSBKGJJNHAPPQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|