C21H19ClN2O5 — CID 143523034
[3-[(3-aminophenyl)methyl]-6-chloro-2-oxo-4-(2-oxopropyl)chromen-7-yl] N-methylcarbamate (PubChem CID 143523034) has the molecular formula C21H19ClN2O5 and a molecular weight of 414.85 g/mol. Its IUPAC name is [3-[(3-aminophenyl)methyl]-6-chloro-2-oxo-4-(2-oxopropyl)chromen-7-yl] N-methylcarbamate.
| Compound Name | [3-[(3-aminophenyl)methyl]-6-chloro-2-oxo-4-(2-oxopropyl)chromen-7-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 143523034 |
| Molecular Formula | C21H19ClN2O5 |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | [3-[(3-aminophenyl)methyl]-6-chloro-2-oxo-4-(2-oxopropyl)chromen-7-yl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1cc2oc(=O)c(Cc3cccc(N)c3)c(CC(C)=O)c2cc1Cl |
| InChI | InChI=1S/C21H19ClN2O5/c1-11(25)6-14-15-9-17(22)19(29-21(27)24-2)10-18(15)28-20(26)16(14)8-12-4-3-5-13(23)7-12/h3-5,7,9-10H,6,8,23H2,1-2H3,(H,24,27) |
| InChIKey | SMUKOYGFMGDPJD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|