C21H16ClN3O3 — CID 59139423
3-[(3-aminophenyl)methyl]-6-chloro-4-methyl-7-pyrimidin-2-yloxychromen-2-one (PubChem CID 59139423) has the molecular formula C21H16ClN3O3 and a molecular weight of 393.83 g/mol. Its IUPAC name is 3-[(3-aminophenyl)methyl]-6-chloro-4-methyl-7-pyrimidin-2-yloxychromen-2-one.
| Compound Name | 3-[(3-aminophenyl)methyl]-6-chloro-4-methyl-7-pyrimidin-2-yloxychromen-2-one |
|---|---|
| PubChem CID | 59139423 |
| Molecular Formula | C21H16ClN3O3 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 3-[(3-aminophenyl)methyl]-6-chloro-4-methyl-7-pyrimidin-2-yloxychromen-2-one |
| SMILES | Cc1c(Cc2cccc(N)c2)c(=O)oc2cc(Oc3ncccn3)c(Cl)cc12 |
| InChI | InChI=1S/C21H16ClN3O3/c1-12-15-10-17(22)19(28-21-24-6-3-7-25-21)11-18(15)27-20(26)16(12)9-13-4-2-5-14(23)8-13/h2-8,10-11H,9,23H2,1H3 |
| InChIKey | XBPCUAQLBCTAIG-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|