C21H24O8 — CID 86228251
3,6-bis(2-methoxyethoxymethoxy)xanthen-9-one (PubChem CID 86228251) has the molecular formula C21H24O8 and a molecular weight of 404.42 g/mol. Its IUPAC name is 3,6-bis(2-methoxyethoxymethoxy)xanthen-9-one.
| Compound Name | 3,6-bis(2-methoxyethoxymethoxy)xanthen-9-one |
|---|---|
| PubChem CID | 86228251 |
| Molecular Formula | C21H24O8 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 3,6-bis(2-methoxyethoxymethoxy)xanthen-9-one |
| SMILES | COCCOCOc1ccc2c(=O)c3ccc(OCOCCOC)cc3oc2c1 |
| InChI | InChI=1S/C21H24O8/c1-23-7-9-25-13-27-15-3-5-17-19(11-15)29-20-12-16(4-6-18(20)21(17)22)28-14-26-10-8-24-2/h3-6,11-12H,7-10,13-14H2,1-2H3 |
| InChIKey | JLRAXURSFQMUNA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 85.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|