C19H16O6 — CID 10065831
2,6-bis(oxiran-2-ylmethoxy)xanthen-9-one (PubChem CID 10065831) has the molecular formula C19H16O6 and a molecular weight of 340.33 g/mol. Its IUPAC name is 2,6-bis(oxiran-2-ylmethoxy)xanthen-9-one.
| Compound Name | 2,6-bis(oxiran-2-ylmethoxy)xanthen-9-one |
|---|---|
| PubChem CID | 10065831 |
| Molecular Formula | C19H16O6 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 2,6-bis(oxiran-2-ylmethoxy)xanthen-9-one |
| SMILES | O=c1c2ccc(OCC3CO3)cc2oc2ccc(OCC3CO3)cc12 |
| InChI | InChI=1S/C19H16O6/c20-19-15-3-1-12(22-8-14-10-24-14)6-18(15)25-17-4-2-11(5-16(17)19)21-7-13-9-23-13/h1-6,13-14H,7-10H2 |
| InChIKey | BPSZHSJEKCITDE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 73.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|